4-Fluorophenyl isothiocyanate
- Product Name4-Fluorophenyl isothiocyanate
- CAS1544-68-9
- CBNumberCB6320252
- MFC7H4FNS
- MW153.18
- EINECS216-280-4
- MDL NumberMFCD00004809
- MOL File1544-68-9.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 24-26 °C (lit.) |
| Boiling point | 228 °C (lit.) |
| Density | 1.25 |
| refractive index | 1.6195-1.6215 |
| Flash point | 193 °F |
| storage temp. | 2-8°C |
| form | powder to lump to clear liquid |
| color | White or Colorless to Yellow |
| Sensitive | Moisture Sensitive |
| BRN | 636596 |
| InChI | InChI=1S/C7H4FNS/c8-6-1-3-7(4-2-6)9-5-10/h1-4H |
| InChIKey | NFIUJHJMCQQYDL-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(N=C=S)C=C1 |
| CAS DataBase Reference | 1544-68-9(CAS DataBase Reference) |
| EWG's Food Scores | 1 |
| NIST Chemistry Reference | Benzene, 1-fluoro-4-isothiocyanato-(1544-68-9) |
| EPA Substance Registry System | p-Fluorophenyl isothiocyanate (1544-68-9) |
| UNSPSC Code | 12352100 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314-H317-H334 | |||||||||
| Precautionary statements | P260-P272-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 | |||||||||
| Hazard Codes | C,T,Xi | |||||||||
| Risk Statements | 34-42 | |||||||||
| Safety Statements | 23-26-36/37-39-45 | |||||||||
| RIDADR | UN 1759 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | NX8760000 | |||||||||
| F | 10-21-19 | |||||||||
| Hazard Note | Toxic/Irritant | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29309090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Resp. Sens. 1 Skin Corr. 1B Skin Sens. 1 | |||||||||
| NFPA 704: |
|
