2,3,5,6-Tetrafluoro-7,7,8,8-tetracyanoquinodimethane
- Product Name2,3,5,6-Tetrafluoro-7,7,8,8-tetracyanoquinodimethane
- CAS29261-33-4
- CBNumberCB5464946
- MFC12F4N4
- MW276.15
- MDL NumberMFCD00042382
- MOL File29261-33-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 285-290 °C(lit.) |
| Boiling point | -89.6±40.0 °C(Predicted) |
| Density | 1.7075 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | Light yellow to Amber to Dark green |
| Water Solubility | insoluble |
| BRN | 2157887 |
| InChI | InChI=1S/C12F4N4/c13-9-7(5(1-17)2-18)10(14)12(16)8(11(9)15)6(3-19)4-20 |
| InChIKey | IXHWGNYCZPISET-UHFFFAOYSA-N |
| SMILES | C1(=C(C#N)C#N)C(F)=C(F)C(=C(C#N)C#N)C(F)=C1F |c:10,t:0| |
| CAS DataBase Reference | 29261-33-4(CAS DataBase Reference) |
| UNSPSC Code | 12352103 |
| NACRES | NA.23 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301+H311+H331 | |||||||||
| Precautionary statements | P280-P301+P310+P330-P302+P352+P312-P304+P340+P311 | |||||||||
| Hazard Codes | Xn,T | |||||||||
| Risk Statements | 36/37/38-20/21/22-23/24/25 | |||||||||
| Safety Statements | 22-24/25-36/37/39-26-36/37 | |||||||||
| RIDADR | 2811 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Toxic | |||||||||
| HazardClass | 6.1(b) | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29269090 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral | |||||||||
| NFPA 704: |
|
