1,2-Bis(trichlorosilyl)ethane
- Product Name1,2-Bis(trichlorosilyl)ethane
- CAS2504-64-5
- CBNumberCB5452934
- MFC2H4Cl6Si2
- MW296.94
- EINECS219-710-9
- MDL NumberMFCD00013601
- MOL File2504-64-5.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 27-29 °C(lit.) |
| Boiling point | 202 °C(lit.) |
| Density | 1.483 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 149 °F |
| storage temp. | 2-8°C |
| form | powder to lump to clear liquid |
| color | White or Colorless to Light yellow |
| Specific Gravity | 1.483 |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 1753707 |
| InChI | 1S/C2H4Cl6Si2/c3-9(4,5)1-2-10(6,7)8/h1-2H2 |
| InChIKey | WDVUXWDZTPZIIE-UHFFFAOYSA-N |
| SMILES | Cl[Si](Cl)(Cl)CC[Si](Cl)(Cl)Cl |
| CAS DataBase Reference | 2504-64-5(CAS DataBase Reference) |
| EPA Substance Registry System | Silane, 1,2-ethanediylbis[trichloro- (2504-64-5) |
| UNSPSC Code | 12352103 |
| NACRES | NA.23 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 14-35 | |||||||||
| Safety Statements | 26-36/37/39-43-45 | |||||||||
| RIDADR | UN 3261 8/PG 1 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29319090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B | |||||||||
| NFPA 704: |
|
