| Melting point |
27-29 °C(lit.) |
| Boiling point |
202 °C(lit.) |
| Density |
1.483 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.475(lit.) |
| Flash point |
149 °F |
| storage temp. |
2-8°C |
| form |
powder to lump to clear liquid |
| color |
White or Colorless to Light yellow |
| Specific Gravity |
1.483 |
| Hydrolytic Sensitivity |
8: reacts rapidly with moisture, water, protic solvents |
| BRN |
1753707 |
| InChI |
1S/C2H4Cl6Si2/c3-9(4,5)1-2-10(6,7)8/h1-2H2 |
| InChIKey |
WDVUXWDZTPZIIE-UHFFFAOYSA-N |
| SMILES |
Cl[Si](Cl)(Cl)CC[Si](Cl)(Cl)Cl |
| CAS DataBase Reference |
2504-64-5(CAS DataBase Reference) |
| EPA Substance Registry System |
Silane, 1,2-ethanediylbis[trichloro- (2504-64-5) |
