4-Amino-2-bromopyridine
- Product Name4-Amino-2-bromopyridine
- CAS7598-35-8
- CBNumberCB5301195
- MFC5H5BrN2
- MW173.01
- EINECS629-178-3
- MDL NumberMFCD01646061
- MOL File7598-35-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 92-96 °C |
| Boiling point | 321.3±22.0 °C(Predicted) |
| Density | 1.710±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 4.89±0.30(Predicted) |
| form | Crystalline Powder or Powder |
| color | White to pale brown to orange |
| Water Solubility | Slightly soluble in water. |
| BRN | 108928 |
| InChI | InChI=1S/C5H5BrN2/c6-5-3-4(7)1-2-8-5/h1-3H,(H2,7,8) |
| InChIKey | GNTGEMWEXKBWBX-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=CC(N)=C1 |
| CAS DataBase Reference | 7598-35-8(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302-H315-H318-H335 | |||||||||
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xn,Xi | |||||||||
| Risk Statements | 22-37/38-41-36/37/38-20/21/22 | |||||||||
| Safety Statements | 26-36/37/39-36/37/38-36-36/37 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Harmful/Irritant | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 29333990 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
