
7598-35-8
| Name | 4-Amino-2-bromopyridine |
| CAS | 7598-35-8 |
| EINECS(EC#) | 629-178-3 |
| Molecular Formula | C5H5BrN2 |
| MDL Number | MFCD01646061 |
| Molecular Weight | 173.01 |
| MOL File | 7598-35-8.mol |
Chemical Properties
| Appearance | Light yellow Cryst |
| Melting point | 92-96 °C |
| Boiling point | 321.3±22.0 °C(Predicted) |
| density | 1.710±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Crystalline Powder or Powder |
| pka | 4.89±0.30(Predicted) |
| color | White to pale brown to orange |
| Water Solubility | Slightly soluble in water. |
| BRN | 108928 |
| InChI | InChI=1S/C5H5BrN2/c6-5-3-4(7)1-2-8-5/h1-3H,(H2,7,8) |
| InChIKey | GNTGEMWEXKBWBX-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=CC(N)=C1 |
| CAS DataBase Reference | 7598-35-8(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |