(+/-)-trans-Epoxysuccinic acid
- Product Name(+/-)-trans-Epoxysuccinic acid
- CAS141-36-6
- CBNumberCB5268810
- MFC4H4O5
- MW132.07
- MDL NumberMFCD01074888
- MOL File141-36-6.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 210-216°C |
| Boiling point | 467.5±45.0 °C(Predicted) |
| Density | 1.920±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| Water Solubility | Soluble in water |
| form | powder to crystal |
| pka | 2.84±0.40(Predicted) |
| color | White to Almost white |
| InChI | InChI=1/C4H4O5/c5-3(6)1-2(9-1)4(7)8/h1-2H,(H,5,6)(H,7,8)/t1-,2-/s3 |
| InChIKey | DCEMCPAKSGRHCN-DLDCVFTPNA-N |
| SMILES | O1[C@@H](C(O)=O)[C@@H]1C(O)=O |&1:1,5,r| |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 36/37/38-22 | |||||||||
| Safety Statements | 26-36/37/39 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2917.20.0000 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|