Perfluoroundecanoic acid
- Product NamePerfluoroundecanoic acid
- CAS2058-94-8
- CBNumberCB5262641
- MFC11HF21O2
- MW564.09
- EINECS218-165-4
- MDL NumberMFCD00153268
- MOL File2058-94-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 96-101 °C(lit.) |
| Boiling point | 160 °C60 mm Hg(lit.) |
| Density | 1.7568 (estimate) |
| Flash point | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 0.52±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| Henry's Law Constant | 1.3×10-2 mol/(m3Pa) at 25℃, Arp et al. (2006) |
| InChI | 1S/C11HF21O2/c12-2(13,1(33)34)3(14,15)4(16,17)5(18,19)6(20,21)7(22,23)8(24,25)9(26,27)10(28,29)11(30,31)32/h(H,33,34) |
| InChIKey | SIDINRCMMRKXGQ-UHFFFAOYSA-N |
| SMILES | OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Substances of Very High Concern (SVHC) Candidate List | Henicosafluoroundecanoic acid (2058-94-8) |
| REACH Annex XVII Substances List | Henicosafluoroundecanoic acid (2058-94-8) |
| EPA Substance Registry System | Undecanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heneicosafluoro- (2058-94-8) |
| UNSPSC Code | 12352106 |
| NACRES | NA.24 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302+H332-H351-H360D-H362-H372 | |||||||||
| Precautionary statements | P202-P260-P263-P301+P312-P304+P340+P312-P308+P313 | |||||||||
| Hazard Codes | Xn,Xi,C | |||||||||
| Risk Statements | 20/21/22-36/38 | |||||||||
| Safety Statements | 26-36/37/39 | |||||||||
| RIDADR | 3261 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Irritant | |||||||||
| HazardClass | IRRITANT, CORROSIVE | |||||||||
| HS Code | 29159000 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Lact. Repr. 1B STOT RE 1 | |||||||||
| NFPA 704: |
|