Perfluoroundecanoic acid
- Product NamePerfluoroundecanoic acid
- CAS2058-94-8
- MFC11HF21O2
- MW564.09
- EINECS218-165-4
- MOL File2058-94-8.mol
Chemical Properties
| Melting point | 96-101 °C(lit.) |
| Boiling point | 160 °C60 mm Hg(lit.) |
| Density | 1.7568 (estimate) |
| Flash point | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 0.52±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| Henry's Law Constant | 1.3×10-2 mol/(m3Pa) at 25℃, Arp et al. (2006) |
| InChI | 1S/C11HF21O2/c12-2(13,1(33)34)3(14,15)4(16,17)5(18,19)6(20,21)7(22,23)8(24,25)9(26,27)10(28,29)11(30,31)32/h(H,33,34) |
| InChIKey | SIDINRCMMRKXGQ-UHFFFAOYSA-N |
| SMILES | OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| EPA Substance Registry System | Undecanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heneicosafluoro- (2058-94-8) |
Safety Information
| Hazard Codes | Xn,Xi,C |
| Risk Statements | 20/21/22-36/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 3261 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, CORROSIVE |
| HS Code | 29159000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Lact. Repr. 1B STOT RE 1 |