1,10-Phenanthrolinium chloride monohydrate
- Product Name1,10-Phenanthrolinium chloride monohydrate
- CAS18851-33-7
- CBNumberCB5230613
- MFC12H11ClN2O
- MW234.68
- EINECS627-064-8
- MDL NumberMFCD00150061
- MOL File18851-33-7.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 224-225 °C(lit.) |
| bulk density | 370kg/m3 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | H2O: 0.1 g/mL, clear |
| form | Solid |
| color | Colorless crystals |
| Water Solubility | Soluble in water. |
| BRN | 4007967 |
| Stability | Stable for 2 year from date of purchase as supplied. Solutions in DMSO or distilled water may be stored at -20°C for up to 3 months. |
| InChI | 1S/C12H8N2.ClH.H2O/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;;/h1-8H;1H;1H2 |
| InChIKey | NDLHUHRGAIHALB-UHFFFAOYSA-N |
| SMILES | O.Cl.c1cnc2c(c1)ccc3cccnc23 |
| UNSPSC Code | 12352107 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H410 | |||||||||
| Precautionary statements | P264-P270-P273-P301+P310-P391-P405 | |||||||||
| Hazard Codes | T,N | |||||||||
| Risk Statements | 25-50/53 | |||||||||
| Safety Statements | 45-60-61 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 8 | |||||||||
| TSCA | Yes | |||||||||
| HS Code | 2933 99 80 | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 | |||||||||
| Toxicity | LD50 orally in Rabbit: 132 mg/kg | |||||||||
| NFPA 704: |
|
