18851-33-7
| Name | 1,10-PHENANTHROLINIUM CHLORIDE MONOHYDRATE |
| CAS | 18851-33-7 |
| EINECS(EC#) | 627-064-8 |
| Molecular Formula | C12H11ClN2O |
| MDL Number | MFCD00150061 |
| Molecular Weight | 234.68 |
| MOL File | 18851-33-7.mol |
Chemical Properties
| Melting point | 224-225 °C(lit.) |
| bulk density | 370kg/m3 |
| storage temp. | Store below +30°C. |
| solubility | H2O: 0.1 g/mL, clear |
| form | Solid |
| color | Colorless crystals |
| Water Solubility | Soluble in water. |
| BRN | 4007967 |
| Stability: | Stable for 2 year from date of purchase as supplied. Solutions in DMSO or distilled water may be stored at -20°C for up to 3 months. |
| InChI | 1S/C12H8N2.ClH.H2O/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;;/h1-8H;1H;1H2 |
| InChIKey | NDLHUHRGAIHALB-UHFFFAOYSA-N |
| SMILES | O.Cl.c1cnc2c(c1)ccc3cccnc23 |
Safety Data
| Hazard Codes | T,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| F | 8 |
| TSCA | Yes |
| HS Code | 2933 99 80 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Toxicity |