2-Bromo-4-methoxyphenylacetic acid
- Product Name2-Bromo-4-methoxyphenylacetic acid
- CAS66916-99-2
- CBNumberCB4760908
- MFC9H9BrO3
- MW245.07
- MDL NumberMFCD02664700
- MOL File66916-99-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 127-131 °C (lit.) |
| Boiling point | 353.6±27.0 °C(Predicted) |
| Density | 1.560±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystaline |
| pka | 4.20±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C9H9BrO3/c1-13-7-3-2-6(4-9(11)12)8(10)5-7/h2-3,5H,4H2,1H3,(H,11,12) |
| InChIKey | XQELSBAAFMYSMG-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=C(OC)C=C1Br |
| CAS DataBase Reference | 66916-99-2(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H400 | |||||||||
| Precautionary statements | P273-P301+P310+P330 | |||||||||
| Hazard Codes | Xn,N | |||||||||
| Risk Statements | 22-50 | |||||||||
| Safety Statements | 60-61 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 2 | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | Ⅲ | |||||||||
| HS Code | 29189900 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 | |||||||||
| NFPA 704: |
|
