2-Amino-3,5-diiodobenzoic acid
- Product Name2-Amino-3,5-diiodobenzoic acid
- CAS609-86-9
- CBNumberCB4413846
- MFC7H5I2NO2
- MW388.93
- EINECS210-201-7
- MDL NumberMFCD00007682
- MOL File609-86-9.mol
Chemical Properties
| Melting point | 241-243 °C(lit.) |
| Boiling point | 441.9±45.0 °C(Predicted) |
| Density | 2.3815 (estimate) |
| pka | 4.24±0.10(Predicted) |
| form | powder to crystal |
| color | White to Gray to Brown |
| Sensitive | Light Sensitive |
| BRN | 779429 |
| InChI | InChI=1S/C7H5I2NO2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2H,10H2,(H,11,12) |
| InChIKey | RFIBDMCPIREZKC-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(I)=CC(I)=C1N |
| CAS DataBase Reference | 609-86-9(CAS DataBase Reference) |
| EWG's Food Scores | 1 |
| EPA Substance Registry System | Benzoic acid, 2-amino-3,5-diiodo- (609-86-9) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H335-H302-H315-H319 | |||||||||
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 22-36/37/38 | |||||||||
| Safety Statements | 26-37/39 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | CB2999300 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 29224985 | |||||||||
| Toxicity | LD50 unr-rat: 180 mg/kg JAPMA8 42,721,53 | |||||||||
| NFPA 704: |
|