Methyl 4-(bromomethyl)-3-methoxybenzoate
- Product NameMethyl 4-(bromomethyl)-3-methoxybenzoate
- CAS70264-94-7
- CBNumberCB4342137
- MFC10H11BrO3
- MW259.1
- EINECS410-310-1
- MDL NumberMFCD00270115
- MOL File70264-94-7.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 92-94°C |
| Boiling point | 324.2±32.0 °C(Predicted) |
| Density | 1.432 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | InChI=1S/C10H11BrO3/c1-13-9-5-7(10(12)14-2)3-4-8(9)6-11/h3-5H,6H2,1-2H3 |
| InChIKey | UXSNXOMMJXTFEG-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(CBr)C(OC)=C1 |
| CAS DataBase Reference | 70264-94-7(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
![]() ![]()
|
| Signal word | Danger |
| Hazard statements | H315-H317-H318-H410 |
| Precautionary statements | P261-P264-P273-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,N |
| Risk Statements | 36/37/38-50/53-43-41-38 |
| Safety Statements | 26-36/37/39-61-60 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 2918999090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Skin Irrit. 2 Skin Sens. 1 |

