2,6-Dichloronicotinonitrile
- Product Name2,6-Dichloronicotinonitrile
- CAS40381-90-6
- CBNumberCB4240189
- MFC6H2Cl2N2
- MW173
- MDL NumberMFCD03411341
- MOL File40381-90-6.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 121-124 °C |
| Boiling point | 286.0±35.0 °C(Predicted) |
| Density | 1.49±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | -5.33±0.10(Predicted) |
| color | White to Light yellow |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C6H2Cl2N2/c7-5-2-1-4(3-9)6(8)10-5/h1-2H |
| InChIKey | LFCADBSUDWERJT-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=CC=C1C#N |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H315-H318-H335 | |||||||||
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 | |||||||||
| Hazard Codes | T | |||||||||
| Risk Statements | 25-41-37/38 | |||||||||
| Safety Statements | 26-39-45 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | Ⅲ | |||||||||
| HS Code | 29333990 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
