Tetrabutylphosphonium chloride
- Product NameTetrabutylphosphonium chloride
- CAS2304-30-5
- CBNumberCB4221908
- MFC16H36ClP
- MW294.88
- EINECS218-964-8
- MDL NumberMFCD00011854
- MOL File2304-30-5.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 62-66 °C (dec.) (lit.) |
| Boiling point | 344.8℃[at 101 325 Pa] |
| Density | 0.978[at 20℃] |
| vapor pressure | 0.018Pa at 25℃ |
| refractive index | 1.5 |
| Flash point | 4°C (39°F) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | liquid |
| color | colorless to pale-yellow |
| Specific Gravity | 0.91 |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| BRN | 4019186 |
| Stability | Hygroscopic |
| InChI | 1S/C16H36P.ClH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | IBWGNZVCJVLSHB-UHFFFAOYSA-M |
| SMILES | [Cl-].CCCC[P+](CCCC)(CCCC)CCCC |
| LogP | -0.44 at 23℃ |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302-H310+H330-H314 | |||||||||
| Precautionary statements | P260-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 | |||||||||
| Hazard Codes | T | |||||||||
| Risk Statements | 22-24-34 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 2928 6.1/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | TA2419000 | |||||||||
| F | 3-10 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 2931.90.9051 | |||||||||
| HazardClass | 6.1(a) | |||||||||
| PackingGroup | II | |||||||||
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | |||||||||
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 3 Dermal Acute Tox. 4 Oral Aquatic Chronic 2 Eye Dam. 1 Skin Corr. 1C Skin Sens. 1B | |||||||||
| NFPA 704: |
|
