1-Cyclohexyl-3-(2-morpholinoethyl)carbodiimide metho-p-toluenesulfonate
- Product Name1-Cyclohexyl-3-(2-morpholinoethyl)carbodiimide metho-p-toluenesulfonate
- CAS2491-17-0
- CBNumberCB4199133
- MFC21H33N3O4S
- MW423.57
- EINECS219-650-3
- MDL NumberMFCD00011979
- MOL File2491-17-0.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 115-120 °C |
| Density | 1.1302 (rough estimate) |
| refractive index | 1.6320 (estimate) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| Water Solubility | Soluble in water |
| solubility | sol DMF, MeCN |
| form | Powder |
| color | White to slightly yellow |
| InChI | InChI=1S/C14H26N3O.C7H8O3S/c1-17(9-11-18-12-10-17)8-7-15-13-16-14-5-3-2-4-6-14;1-6-2-4-7(5-3-6)11(8,9)10/h14H,2-12H2,1H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | GBCAVSYHPPARHX-UHFFFAOYSA-M |
| SMILES | [N+]1(C)(CCN=C=NC2CCCCC2)CCOCC1.C1(S([O-])(=O)=O)=CC=C(C)C=C1 |
| EPA Substance Registry System | Morpholinium, 4-[2-[(cyclohexylcarbonimidoyl)amino]ethyl]-4-methyl-, salt with 4-methylbenzenesulfonic acid (1:1) (2491-17-0) |
| UNSPSC Code | 12352111 |
| NACRES | NA.26 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 29349990 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| NFPA 704: |
|
