Tetra-n-butylammonium tetraphenylborate
- Product NameTetra-n-butylammonium tetraphenylborate
- CAS15522-59-5
- CBNumberCB4133603
- MFC40H56BN
- MW561.71
- EINECS239-562-9
- MDL NumberMFCD00011749
- MOL File15522-59-5.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 230-236 °C(lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | acetonitrile: 0.1 g/mL, clear, colorless |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | Soluble in pyridine, acetone, water. |
| Sensitive | Hygroscopic |
| BRN | 3857215 |
| Stability | Stable. Incompatible with strong oxidizing agents. Hygroscopic. |
| InChIKey | ZHCCBGAUZWZGQV-UHFFFAOYSA-N |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.c1ccc(cc1)[B-](c2ccccc2)(c3ccccc3)c4ccccc4 |
| UNSPSC Code | 26111700 |
| NACRES | NB.61 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 8-9 | |||||||||
| HS Code | 2923.90.0100 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
