Fmoc-sarcosine monohydrate
- Product NameFmoc-sarcosine monohydrate
- CAS77128-70-2
- CBNumberCB4131977
- MFC18H17NO4
- MW311.33
- EINECS674-628-4
- MDL NumberMFCD00151926
- MOL File77128-70-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 117.0 to 121.0 °C |
| Boiling point | 512.8±29.0 °C(Predicted) |
| Density | 1.292±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in DMF. |
| form | powder to crystal |
| pka | 3.91±0.10(Predicted) |
| color | White to Almost white |
| BRN | 6660958 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C18H17NO4/c1-19(10-17(20)21)18(22)23-11-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-9,16H,10-11H2,1H3,(H,20,21) |
| InChIKey | ZHKQIADIIYMFOZ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CN(C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)C |
| CAS DataBase Reference | 77128-70-2(CAS DataBase Reference) |
| UNSPSC Code | 12352209 |
| NACRES | NA.26 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P271-P261 | |||||||||
| Safety Statements | 22-24/25 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2924 29 70 | |||||||||
| HazardClass | IRRITANT | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| NFPA 704: |
|

