Diiron nonacarbonyl
- Product NameDiiron nonacarbonyl
- CAS15321-51-4
- CBNumberCB4114295
- MFC9Fe2O9
- MW363.78
- EINECS239-359-5
- MDL NumberMFCD00151465
- MOL File15321-51-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 100 °C |
| Boiling point | 209°C (rough estimate) |
| Density | 2,85 g/cm3 |
| storage temp. | 2-8°C |
| form | crystal |
| Specific Gravity | 2.85 |
| color | yellow to orange |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: TWA 1 mg/m3 |
| InChI | InChI=1S/9CO.2Fe/c9*1-2;;/q;;;;;;3*-2;2*+3 |
| InChIKey | XFXXNNZZAYCFEV-UHFFFAOYSA-N |
| SMILES | C([Fe+3]123([C-2]([Fe+3]1([C-2]2=O)([C-2]3=O)(C#[O])(C#[O])C#[O])=O)(C#[O])C#[O])#[O] |
| EPA Substance Registry System | Iron, tri-.mu.-carbonylhexacarbonyldi-, (Fe-Fe) (15321-51-4) |
| UNSPSC Code | 12161600 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H228-H261-H301+H331 | |||||||||
| Precautionary statements | P210-P231+P232-P301+P310+P330-P304+P340+P311 | |||||||||
| Hazard Codes | F,T | |||||||||
| Risk Statements | 11-23/25 | |||||||||
| Safety Statements | 16-28-36/37/39-45 | |||||||||
| RIDADR | UN 2930 6.1/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 4.8-25 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29310099 | |||||||||
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water | |||||||||
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Sol. 2 Water-react 2 | |||||||||
| NFPA 704: |
|
