
15321-51-4
| Name | DIIRON NONACARBONYL |
| CAS | 15321-51-4 |
| EINECS(EC#) | 239-359-5 |
| Molecular Formula | C9Fe2O9 |
| MDL Number | MFCD00151465 |
| Molecular Weight | 363.78 |
| MOL File | 15321-51-4.mol |
Chemical Properties
| Appearance | yellow to orange platelets |
| Melting point | 100 °C |
| Boiling point | 209°C (rough estimate) |
| density | 2,85 g/cm3 |
| storage temp. | 2-8°C |
| form | crystal |
| color | yellow to orange |
| Specific Gravity | 2.85 |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: TWA 1 mg/m3 |
| InChI | InChI=1S/9CO.2Fe/c9*1-2;;/q;;;;;;3*-2;2*+3 |
| InChIKey | XFXXNNZZAYCFEV-UHFFFAOYSA-N |
| SMILES | C([Fe+3]123([C-2]([Fe+3]1([C-2]2=O)([C-2]3=O)(C#[O])(C#[O])C#[O])=O)(C#[O])C#[O])#[O] |
| EPA Substance Registry System | Iron, tri-.mu.-carbonylhexacarbonyldi-, (Fe-Fe) (15321-51-4) |
Safety Data
| Hazard Codes | F,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2930 6.1/PG 2 |
| WGK Germany | 3 |
| F | 4.8-25 |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29310099 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Sol. 2 Water-react 2 |