2-Cyano-5-nitroanisole
- Product Name2-Cyano-5-nitroanisole
- CAS101084-96-2
- CBNumberCB3758964
- MFC8H6N2O3
- MW178.14
- EINECS278-669-5
- MDL NumberMFCD02093781
- MOL File101084-96-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 177-180 °C (lit.) |
| Boiling point | 364.5±27.0 °C(Predicted) |
| Density | 1.32 |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| λmax | 335nm(MeOH)(lit.) |
| InChI | 1S/C8H6N2O3/c1-13-8-4-7(10(11)12)3-2-6(8)5-9/h2-4H,1H3 |
| InChIKey | MLIKCKXLGYEGAO-UHFFFAOYSA-N |
| SMILES | COc1cc(ccc1C#N)[N+]([O-])=O |
| CAS DataBase Reference | 101084-96-2 |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302+H312+H332-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 20/21/22-36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| RIDADR | UN3439 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2926907090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
