101084-96-2
| Name | 2-CYANO-5-NITROANISOLE |
| CAS | 101084-96-2 |
| EINECS(EC#) | 278-669-5 |
| Molecular Formula | C8H6N2O3 |
| MDL Number | MFCD02093781 |
| Molecular Weight | 178.14 |
| MOL File | 101084-96-2.mol |
Chemical Properties
| Melting point | 177-180 °C(lit.) |
| Boiling point | 364.5±27.0 °C(Predicted) |
| density | 1.32 |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| λmax | 335nm(MeOH)(lit.) |
| InChI | 1S/C8H6N2O3/c1-13-8-4-7(10(11)12)3-2-6(8)5-9/h2-4H,1H3 |
| InChIKey | MLIKCKXLGYEGAO-UHFFFAOYSA-N |
| SMILES | COc1cc(ccc1C#N)[N+]([O-])=O |
| CAS DataBase Reference | 101084-96-2 |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN3439 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2926907090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |