| Melting point |
163 °C |
| Boiling point |
556℃ |
| Density |
1.517 |
| refractive index |
-39.5 ° (C=1, H2O) |
| Flash point |
290℃ |
| storage temp. |
Keep in dark place,Inert atmosphere,2-8°C |
| solubility |
water: 49.00-51.00 mg/mL, clear, colorless to yellow |
| form |
powder |
| pka |
12.93±0.70(Predicted) |
| color |
white to yellow cast |
| biological source |
rabbit |
| optical activity |
[α]/D -42.00 to -34.00°, c =9.00-11.00 mg/mL in water |
| Water Solubility |
water: 49.00-51.00mg/mL, clear, colorless to yellow |
| InChI |
InChI=1/C12H17NO6/c13-6-1-3-7(4-2-6)18-12-11(17)10(16)9(15)8(5-14)19-12/h1-4,8-12,14-17H,5,13H2/t8-,9+,10+,11-,12-/s3 |
| InChIKey |
MIAKOEWBCMPCQR-YBXAARCKSA-N |
| SMILES |
O(C1C=CC(N)=CC=1)[C@H]1[C@@H]([C@@H](O)[C@@H](O)[C@@H](CO)O1)O |&1:8,9,10,12,14,r| |
| CAS DataBase Reference |
5094-33-7(CAS DataBase Reference) |
| UNSPSC Code |
12352203 |
| NACRES |
NA.41 |
