Tributylphenyltin
- Product NameTributylphenyltin
- CAS960-16-7
- CBNumberCB3437560
- MFC18H32Sn
- MW367.16
- MDL NumberMFCD00134394
- MOL File960-16-7.mol
- MSDS FileSDS
Chemical Properties
| Melting point | <0°C |
| Boiling point | 125-128 °C/0.14 mmHg (lit.) |
| Density | 1.125 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Storage temp. -20°C |
| solubility | Sparingly Soluble (9.9E-5 g/L) (25°C) |
| form | Oil |
| color | Colourless to Light Yellow |
| Specific Gravity | 1.125 |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| BRN | 3610571 |
| Stability | Moisture Sensitive |
| InChI | 1S/C6H5.3C4H9.Sn/c1-2-4-6-5-3-1;3*1-3-4-2;/h1-5H;3*1,3-4H2,2H3; |
| InChIKey | SYUVAXDZVWPKSI-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccccc1 |
| UNSPSC Code | 12352103 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H312-H315-H319-H360FD-H372-H410 | |||||||||
| Precautionary statements | P202-P273-P280-P301+P310-P302+P352+P312-P305+P351+P338 | |||||||||
| Hazard Codes | T,N | |||||||||
| Risk Statements | 21-25-36/38-48/23/25-50/53 | |||||||||
| Safety Statements | 35-36/37/39-45-60-61 | |||||||||
| RIDADR | UN 2788 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| TSCA | No | |||||||||
| HazardClass | 6.1(a) | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29319090 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 | |||||||||
| NFPA 704: |
|