960-16-7
| Name | TRIBUTYLPHENYLTIN |
| CAS | 960-16-7 |
| Molecular Formula | C18H32Sn |
| MDL Number | MFCD00134394 |
| Molecular Weight | 367.16 |
| MOL File | 960-16-7.mol |
Chemical Properties
| Appearance | Clear colorless liquid |
| Melting point | <0°C |
| Boiling point | 125-128 °C0.14 mm Hg(lit.) |
| density | 1.125 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Storage temp. -20°C |
| solubility | Sparingly Soluble (9.9E-5 g/L) (25°C) |
| form | Oil |
| color | Colourless to Light Yellow |
| Specific Gravity | 1.125 |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| BRN | 3610571 |
| Stability: | Moisture Sensitive |
| InChI | 1S/C6H5.3C4H9.Sn/c1-2-4-6-5-3-1;3*1-3-4-2;/h1-5H;3*1,3-4H2,2H3; |
| InChIKey | SYUVAXDZVWPKSI-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccccc1 |
Safety Data
| Hazard Codes | T,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2788 6.1/PG 3 |
| WGK Germany | 3 |
| TSCA | No |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29319090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |