Tetrachlorophthalic anhydride
- Product NameTetrachlorophthalic anhydride
- CAS117-08-8
- CBNumberCB3313062
- MFC8Cl4O3
- MW285.9
- EINECS204-171-4
- MDL NumberMFCD00005920
- MOL File117-08-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 253-257 °C(lit.) |
| Boiling point | 371 °C(lit.) |
| Density | 1.49 |
| vapor pressure | 0.16 mm Hg ( 145 °C) |
| Flash point | 362°C |
| storage temp. | Store below +30°C. |
| solubility | Chloroform (Slightly, Heated), DMSO (Heated), Methanol (Slightly, Heated) |
| pka | 3.01[at 20 ℃] |
| form | Flakes |
| color | White to off-white |
| Water Solubility | 0.8 mg/L (21 ºC) |
| Sensitive | Moisture Sensitive |
| BRN | 211560 |
| Exposure limits | ACGIH: TWA 0.002 mg/m3 (Skin) |
| Stability | Stable. Reacts with water. Combustible. Incompatible with strong oxidizing agents. Air and moisture sensitive. |
| InChI | 1S/C8Cl4O3/c9-3-1-2(8(14)15-7(1)13)4(10)6(12)5(3)11 |
| InChIKey | AUHHYELHRWCWEZ-UHFFFAOYSA-N |
| SMILES | Clc1c(Cl)c(Cl)c2C(=O)OC(=O)c2c1Cl |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H317-H318-H334-H350-H373-H410 | |||||||||
| Precautionary statements | P201-P261-P273-P280-P305+P351+P338-P308+P313 | |||||||||
| Hazard Codes | T,N,Xn | |||||||||
| Risk Statements | 45-41-42/43-50/53-48/22 | |||||||||
| Safety Statements | 53-22-24-26-37/39-45-60-61-36/37/39 | |||||||||
| RIDADR | UN 3077 9/PG 3 | |||||||||
| WGK Germany | 2 | |||||||||
| RTECS | TI3450000 | |||||||||
| F | 10-21 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 9 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29173990 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 1B Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 STOT RE 2 | |||||||||
| Hazardous Substances Data | 117-08-8(Hazardous Substances Data) | |||||||||
| Toxicity | LD50 orally in Rabbit: > 15800 mg/kg LD50 dermal Rabbit > 5000 mg/kg | |||||||||
| NFPA 704: |
|
