Tris(dibenzoylmethane)mono(phenanthroline)europium (III)
- Product NameTris(dibenzoylmethane)mono(phenanthroline)europium (III)
- CAS17904-83-5
- CBNumberCB3142798
- MFC57H41EuN2O6
- MW1001.91
- MDL NumberMFCD01321202
- MOL File17904-83-5.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 185-191 °C(lit.) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in dichloromethane, THF |
| form | Powder |
| color | Light yellow to Yellow to Orange |
| λmax | 228 nm |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | 1S/3C15H12O2.C12H8N2.Eu/c3*16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13;1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h3*1-11,16H;1-8H;/q;;;;+3/p-3/b3*14-11+;; |
| InChIKey | VFVBZVBAWCSCIO-RWBKAWJDSA-K |
| SMILES | C12N=CC=CC=1C=CC1C=CC=NC2=1.[Eu](O/C(=C/C(=O)C1C=CC=CC=1)/C1C=CC=CC=1)(O/C(=C/C(=O)C1C=CC=CC=1)/C1C=CC=CC=1)O/C(=C/C(=O)C1C=CC=CC=1)/C1C=CC=CC=1 |
| CAS DataBase Reference | 17904-83-5(CAS DataBase Reference) |
| Absorption | λmax 257 nm, 355 nm in THF |
| UNSPSC Code | 12352103 |
| NACRES | NA.23 |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302+H332-H314-H334 | |||||||||
| Precautionary statements | P501-P260-P270-P271-P264-P280-P284-P342+P311-P303+P361+P353-P301+P330+P331-P363-P301+P312+P330-P304+P340+P310-P305+P351+P338+P310-P405 | |||||||||
| Safety Statements | 24/25 | |||||||||
| WGK Germany | 3 | |||||||||
| TSCA | No | |||||||||
| HS Code | 28469099 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| NFPA 704: |
|
