3,5-Dimethoxybenzoyl chloride
- Product Name3,5-Dimethoxybenzoyl chloride
- CAS17213-57-9
- CBNumberCB3103122
- MFC9H9ClO3
- MW200.62
- EINECS241-256-5
- MDL NumberMFCD00000676
- MOL File17213-57-9.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 43-46 °C (lit.) |
| Boiling point | 157-158 °C/16 mmHg (lit.) |
| Density | 1.2799 (rough estimate) |
| refractive index | 1.5230 (estimate) |
| Flash point | >230 °F |
| storage temp. | RT, stored under nitrogen |
| form | powder to lump |
| color | White to Light yellow |
| Water Solubility | It hydrolyzes in water. |
| Sensitive | Moisture Sensitive |
| BRN | 511839 |
| InChI | InChI=1S/C9H9ClO3/c1-12-7-3-6(9(10)11)4-8(5-7)13-2/h3-5H,1-2H3 |
| InChIKey | FTHPLWDYWAKYCY-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC(OC)=CC(OC)=C1 |
| CAS DataBase Reference | 17213-57-9(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 3261 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-19-21 | |||||||||
| HS Code | 2916.39.7900 | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Skin Corr. 1B | |||||||||
| NFPA 704: |
|
