1,2,3,4-Tetrahydro-9-methylcarbazol-4-one
- Product Name1,2,3,4-Tetrahydro-9-methylcarbazol-4-one
- CAS27387-31-1
- CBNumberCB2441827
- MFC13H13NO
- MW199.25
- EINECS608-096-1
- MDL NumberMFCD00173748
- MOL File27387-31-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 199.0 to 203.0 °C |
| Boiling point | 383.5±11.0 °C(Predicted) |
| Density | 1.21±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly, Heated, Sonicated) |
| form | solid |
| color | White to Light yellow |
| BRN | 153862 |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C13H13NO/c1-14-10-6-3-2-5-9(10)13-11(14)7-4-8-12(13)15/h2-3,5-6H,4,7-8H2,1H3 |
| InChIKey | HHJUJCWZKJMCLC-UHFFFAOYSA-N |
| SMILES | N1(C)C2=C(C=CC=C2)C2=C1CCCC2=O |
| CAS DataBase Reference | 27387-31-1(CAS DataBase Reference) |
| FDA UNII | 267IW42T7Z |
| UNSPSC Code | 41116107 |
| NACRES | NA.24 |
Safety
| Symbol(GHS) |
|
| Signal word | Danger |
| Hazard statements | H301-H412 |
| Precautionary statements | P264-P270-P273-P301+P310-P405-P501 |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-52/53-25 |
| Safety Statements | 22-24/25-61-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | WGK 3 |
| HS Code | 2933998090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 3 |

