2-ACETYLDIMEDONE
- Product Name2-ACETYLDIMEDONE
- CAS1755-15-3
- CBNumberCB2415765
- MFC10H14O3
- MW182.22
- MDL NumberMFCD00467663
- MOL File1755-15-3.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 36-40 °C |
| Boiling point | 132-133 °C |
| Density | 1.077±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | powder to lump to clear liquid |
| pka | 3.56±0.42(Predicted) |
| color | White or Colorless to Yellow |
| BRN | 2089698 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C10H14O3/c1-6(11)9-7(12)4-10(2,3)5-8(9)13/h9H,4-5H2,1-3H3 |
| InChIKey | ITSKWKZDPHAQNK-UHFFFAOYSA-N |
| SMILES | C1(=O)CC(C)(C)CC(=O)C1C(C)=O |
| CAS DataBase Reference | 1755-15-3 |
| FDA UNII | 4M7FS82U08 |
| Proposition 65 List | DDE (Dichlorodiphenyldichloroethylene) |
| UNSPSC Code | 12352115 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2914290090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| Toxicity | Principal metabolite of DDT in humans and other animals. Principal long-term storage form derived from DDT in humans and other animals. Biological half-life of several years. DDE is probably related to the chronic toxic effects of DDT such as eggshell thinning. It has been suggested recently that DDT, its metabolites, and other persistent organochlorines are possibly involved in cancer causation, particularly human breast cancer. | |||||||||
| NFPA 704: |
|
