1755-15-3
| Name | 2-ACETYLDIMEDONE |
| CAS | 1755-15-3 |
| Molecular Formula | C10H14O3 |
| MDL Number | MFCD00467663 |
| Molecular Weight | 182.22 |
| MOL File | 1755-15-3.mol |
Chemical Properties
| Melting point | 36 °C |
| Boiling point | 132-133 °C |
| density | 1.077±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | powder to lump to clear liquid |
| pka | 3.56±0.42(Predicted) |
| color | White or Colorless to Yellow |
| BRN | 2089698 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C10H14O3/c1-6(11)9-7(12)4-10(2,3)5-8(9)13/h9H,4-5H2,1-3H3 |
| InChIKey | ITSKWKZDPHAQNK-UHFFFAOYSA-N |
| SMILES | C1(=O)CC(C)(C)CC(=O)C1C(C)=O |
| CAS DataBase Reference | 1755-15-3 |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 2914290090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |