4-Chlorophenyl cyclopropyl ketone
- Product Name4-Chlorophenyl cyclopropyl ketone
- CAS6640-25-1
- CBNumberCB2352545
- MFC10H9ClO
- MW180.63
- EINECS229-655-2
- MDL NumberMFCD00001295
- MOL File6640-25-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 29-31 °C(lit.) |
| Boiling point | 135-137°C 10mm |
| Density | 1.16 |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to lump to clear liquid |
| color | White or Colorless to Yellow to Orange |
| BRN | 2044845 |
| InChI | InChI=1S/C10H9ClO/c11-9-5-3-8(4-6-9)10(12)7-1-2-7/h3-7H,1-2H2 |
| InChIKey | OPSFCTBBDIDFJM-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(Cl)C=C1)(C1CC1)=O |
| CAS DataBase Reference | 6640-25-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Chlorophenyl cyclopropyl ketone(6640-25-1) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 24/25-36-26 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2914790090 | |||||||||
| NFPA 704: |
|
