| Melting point |
29-31 °C(lit.) |
| Boiling point |
135-137°C 10mm |
| Density |
1.16 |
| refractive index |
n20/D 1.5718(lit.) |
| Flash point |
>230 °F |
| storage temp. |
Sealed in dry,Room Temperature |
| form |
powder to lump to clear liquid |
| color |
White or Colorless to Yellow to Orange |
| BRN |
2044845 |
| InChI |
InChI=1S/C10H9ClO/c11-9-5-3-8(4-6-9)10(12)7-1-2-7/h3-7H,1-2H2 |
| InChIKey |
OPSFCTBBDIDFJM-UHFFFAOYSA-N |
| SMILES |
C(C1=CC=C(Cl)C=C1)(C1CC1)=O |
| CAS DataBase Reference |
6640-25-1(CAS DataBase Reference) |
| NIST Chemistry Reference |
4-Chlorophenyl cyclopropyl ketone(6640-25-1) |
