Tetranitroblue tetrazolium chloride
- Product NameTetranitroblue tetrazolium chloride
- CAS1184-43-6
- CBNumberCB2270290
- MFC40H28ClN12O10+
- MW872.19
- EINECS214-665-1
- MDL NumberMFCD00036338
- MOL File1184-43-6.mol
- MSDS FileSDS
Chemical Properties
| Melting point | ~170 °C (dec.) |
| storage temp. | 2-8°C |
| solubility | Soluble in water, ethanol, methanol, N,Ndimethylformamide |
| form | crystals or powder |
| color | Yellow |
| Odor | Odorless |
| Water Solubility | water: 1mg/mL, clear to hazy, yellow |
| λmax | 279 nm |
| BRN | 3897475 |
| Biological Applications | Diagnosis of bacterial vaginosis; detecting alkaline phosphatase,gamma-hydroxybutyric acid (GHB),succinate dehydrogenase activity; generating and detecting reactive oxygen species; treating cancer |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChIKey | VCESGVLABVSDRO-UHFFFAOYSA-L |
| SMILES | [Cl-].[Cl-].COc1cc(ccc1-[n+]2nc(nn2-c3ccc(cc3)[N+]([O-])=O)-c4ccc(cc4)[N+]([O-])=O)-c5ccc(c(OC)c5)-[n+]6nc(nn6-c7ccc(cc7)[N+]([O-])=O)-c8ccc(cc8)[N+]([O-])=O |
| CAS DataBase Reference | 1184-43-6(CAS DataBase Reference) |
| EPA Substance Registry System | 2H-Tetrazolium, 2,2'-(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis[3,5-bis(4-nitrophenyl)-, dichloride (1184-43-6) |
| UNSPSC Code | 12352204 |
| NACRES | NA.83 |
Safety
| Symbol(GHS) |
|
| Signal word | Danger |
| Hazard statements | H350 |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| Hazard Codes | T |
| Risk Statements | 45 |
| Safety Statements | 53 |
| RIDADR | UN 1325 4.1/PG III |
| WGK Germany | 3 |
| F | 3-8-10 |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 1B |
