| Melting point |
255 °C (dec.)(lit.) |
| Density |
1.9137 (rough estimate) |
| refractive index |
1.6000 (estimate) |
| storage temp. |
room temp |
| solubility |
Soluble in water;freely soluble ethanol, methanol, chloroform; insoluble in acetone, ether, ethyl acetate |
| form |
crystals or powder |
| color |
Lemon yellow |
| Odor |
Odorless |
| biological source |
bovine nose |
| Water Solubility |
Soluble in hot water (5 mg/ml), methanol (50 mg/ml), ethanol, and chloroform. Insoluble in acetone. |
| λmax |
253 nm |
| Merck |
14,9244 |
| BRN |
3894077 |
| Stability |
Stable, but may be light sensitive. Incompatible with strong oxidizing agents. |
| Major Application |
microbiology |
| Biological Applications |
Cellular response evaluation assays; microbial growth assays; tannins assays; anti-cancer agents; diagnostic test strips; detecting lactate dehydrogenase (LDH) isoenzymes,gamma-hydroxybutyric acid (GHB); measuring ATP,numb |
| InChIKey |
MUUHXGOJWVMBDY-UHFFFAOYSA-L |
| SMILES |
[Cl-].[Cl-].COc1cc(ccc1-[n+]2nc(nn2-c3ccccc3)-c4ccccc4)-c5ccc(c(OC)c5)-[n+]6nc(nn6-c7ccccc7)-c8ccccc8 |
| CAS DataBase Reference |
1871-22-3(CAS DataBase Reference) |
| FDA UNII |
0468TBH014 |
| EPA Substance Registry System |
2H-Tetrazolium, 2,2'-(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis[3,5-diphenyl-, dichloride (1871-22-3) |
| UNSPSC Code |
41106514 |
| NACRES |
NA.83 |