2-Cyanothioacetamide
- Product Name2-Cyanothioacetamide
- CAS7357-70-2
- CBNumberCB1377796
- MFC3H4N2S
- MW100.14
- MDL NumberMFCD00010025
- MOL File7357-70-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 118-120 °C (lit.) |
| Boiling point | 264.0±42.0 °C(Predicted) |
| Density | 1.241 (estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Needles or Powder |
| pka | 12.18±0.29(Predicted) |
| color | Beige to brown |
| Water Solubility | Does not mix well with water. |
| Sensitive | Light Sensitive |
| BRN | 1699934 |
| InChI | InChI=1S/C3H4N2S/c4-2-1-3(5)6/h1H2,(H2,5,6) |
| InChIKey | BHPYMZQTCPRLNR-UHFFFAOYSA-N |
| SMILES | C(N)(=S)CC#N |
| CAS DataBase Reference | 7357-70-2(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302+H312+H332-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 20/21/22-36/37/38 | |||||||||
| Safety Statements | 26-37/39-36/37/39-36 | |||||||||
| RIDADR | UN 3439 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Harmful/Light Sensitive | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29309090 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
