7357-70-2
| Name | 2-Cyanothioacetamide |
| CAS | 7357-70-2 |
| Molecular Formula | C3H4N2S |
| MDL Number | MFCD00010025 |
| Molecular Weight | 100.14 |
| MOL File | 7357-70-2.mol |
Chemical Properties
| Appearance | beige to brown needles or powder |
| Melting point | 118-120 °C (lit.) |
| Boiling point | 264.0±42.0 °C(Predicted) |
| density | 1.241 (estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Needles or Powder |
| pka | 12.18±0.29(Predicted) |
| color | Beige to brown |
| Water Solubility | Does not mix well with water. |
| Sensitive | Light Sensitive |
| BRN | 1699934 |
| InChI | InChI=1S/C3H4N2S/c4-2-1-3(5)6/h1H2,(H2,5,6) |
| InChIKey | BHPYMZQTCPRLNR-UHFFFAOYSA-N |
| SMILES | C(N)(=S)CC#N |
| CAS DataBase Reference | 7357-70-2(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3439 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Light Sensitive |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29309090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |