O-Benzyl-D-serine
- Product NameO-Benzyl-D-serine
- CAS10433-52-0
- CBNumberCB0724401
- MFC10H13NO3
- MW195.22
- EINECS233-916-6
- MDL NumberMFCD00065936
- MOL File10433-52-0.mol
Chemical Properties
| Melting point | ~227 °C (dec.) |
| Boiling point | 359.1±37.0 °C(Predicted) |
| Density | 1.217 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 2.10±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| optical activity | [α]20/D 22±2°, c = 2% in acetic acid: water (4:1) (+ 1 Eq HCl) |
| BRN | 2649409 |
| InChI | InChI=1S/C10H13NO3/c11-9(10(12)13)7-14-6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13)/t9-/m1/s1 |
| InChIKey | IDGQXGPQOGUGIX-SECBINFHSA-N |
| SMILES | C(O)(=O)[C@@H](COCC1=CC=CC=C1)N |
| CAS DataBase Reference | 10433-52-0(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
  
|
| Signal word | Danger |
| Hazard statements | H301-H318-H317-H410 |
| Precautionary statements | P501-P261-P273-P272-P270-P264-P280-P302+P352-P391-P362+P364-P333+P313-P301+P310+P330-P305+P351+P338+P310-P405 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2922500090 |
