| Melting point |
~227 °C (dec.) |
| Boiling point |
359.1±37.0 °C(Predicted) |
| Density |
1.217 |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| form |
powder to crystal |
| pka |
2.10±0.10(Predicted) |
| color |
White to Almost white |
| optical activity |
[α]20/D 22±2°, c = 2% in acetic acid: water (4:1) (+ 1 Eq HCl) |
| BRN |
2649409 |
| Major Application |
peptide synthesis |
| InChI |
InChI=1S/C10H13NO3/c11-9(10(12)13)7-14-6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13)/t9-/m1/s1 |
| InChIKey |
IDGQXGPQOGUGIX-SECBINFHSA-N |
| SMILES |
C(O)(=O)[C@@H](COCC1=CC=CC=C1)N |
| CAS DataBase Reference |
10433-52-0(CAS DataBase Reference) |
