13C15 DON
- Product Name13C15 DON
- CAS911392-36-4
- CBNumberCB0434487
- MFC15H20O6
- MW311.21
- EINECS809-626-6
- MDL NumberMFCD08460519
- MOL FileMol file
- MSDS FileSDS
Chemical Properties
| Density | 1.486±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) |
| Flash point | 2℃ |
| storage temp. | -20°C |
| solubility | Acetonitrile: soluble |
| form | Liquid |
| color | Colorless to light yellow |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| InChIKey | LINOMUASTDIRTM-YGEUXOLBSA-N |
| SMILES | [13CH3][13C]1=[13CH][13C@H]2O[13C@@H]3[13C@H](O)[13CH2][13C@@]([13CH3])([13C@]34[13CH2]O4)[13C@@]2([13CH2]O)[13C@H](O)[13C]1=O |
| UNSPSC Code | 85151701 |
| NACRES | NA.24 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H225-H302-H312-H319-H332 | |||||||||
| Precautionary statements | P210-P280-P305+P351+P338 | |||||||||
| Hazard Codes | F,Xn | |||||||||
| Risk Statements | 11-20/21/22-36 | |||||||||
| Safety Statements | 16-36/37 | |||||||||
| RIDADR | UN 1648 3 / PGII | |||||||||
| WGK Germany | 2 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 | |||||||||
| NFPA 704: |
|