911392-36-4
| Name | 13C15 DON |
| CAS | 911392-36-4 |
| EINECS(EC#) | 809-626-6 |
| Molecular Formula | C15H20O6 |
| MDL Number | MFCD08460519 |
| Molecular Weight | 311.45 |
| MOL File | 911392-36-4.mol |
Chemical Properties
| density | 1.486±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) |
| Fp | 2℃ |
| storage temp. | -20°C |
| solubility | Acetonitrile: soluble |
| form | Liquid |
| color | Colorless to light yellow |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| InChIKey | LINOMUASTDIRTM-YGEUXOLBSA-N |
| SMILES | [13CH3][13C]1=[13CH][13C@H]2O[13C@@H]3[13C@H](O)[13CH2][13C@@]([13CH3])([13C@]34[13CH2]O4)[13C@@]2([13CH2]O)[13C@H](O)[13C]1=O |
Safety Data
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H302-H312-H319-H332 |
| Precautionary statements | P210-P280-P305+P351+P338 |
| Hazard Codes | F,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | 2 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |