Chemical Properties
| Density | 1.486±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) |
| Flash point | 2℃ |
| storage temp. | -20°C |
| solubility | Acetonitrile: soluble |
| form | Liquid |
| color | Colorless to light yellow |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| InChIKey | LINOMUASTDIRTM-YGEUXOLBSA-N |
| SMILES | [13CH3][13C]1=[13CH][13C@H]2O[13C@@H]3[13C@H](O)[13CH2][13C@@]([13CH3])([13C@]34[13CH2]O4)[13C@@]2([13CH2]O)[13C@H](O)[13C]1=O |
Safety Information
| Hazard Codes | F,Xn |
| Risk Statements | 11-20/21/22-36 |
| Safety Statements | 16-36/37 |
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | 2 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |