Oxyclozanide
- Product NameOxyclozanide
- CAS2277-92-1
- CBNumberCB0285744
- MFC13H6Cl5NO3
- MW401.46
- EINECS218-904-0
- MDL NumberMFCD00864507
- MOL File2277-92-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 77-81C |
| Boiling point | 215C |
| Density | 1.6274 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 5.07±0.50(Predicted) |
| form | Solid |
| color | White to off-white |
| Water Solubility | 29mg/L(25 ºC) |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | InChI=1S/C13H6Cl5NO3/c14-4-1-6(16)11(20)8(2-4)19-13(22)9-10(18)5(15)3-7(17)12(9)21/h1-3,20-21H,(H,19,22) |
| InChIKey | JYWIYHUXVMAGLG-UHFFFAOYSA-N |
| SMILES | C(NC1=CC(Cl)=CC(Cl)=C1O)(=O)C1=C(O)C(Cl)=CC(Cl)=C1Cl |
| CAS DataBase Reference | 2277-92-1(CAS DataBase Reference) |
| FDA UNII | 1QS9G4876X |
| UNSPSC Code | 41116107 |
| NACRES | NA.24 |
Safety
| Symbol(GHS) |
![]()
|
| Signal word | Warning |
| Hazard statements | H302-H410 |
| Precautionary statements | P264-P270-P273-P301+P312-P391-P501 |
| Hazard Codes | Xn;N,N,Xn,Xi |
| Risk Statements | 22-50/53-36/37/38 |
| Safety Statements | 60-61-36-26 |
| RIDADR | UN 3077 |
| WGK Germany | 3 |
| RTECS | CV8576000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |


