94442-22-5
| Name | (Trimethyl)methylcyclopentadienylplatinum(IV) |
| CAS | 94442-22-5 |
| EINECS(EC#) | 629-612-1 |
| Molecular Formula | C9H17Pt- |
| MDL Number | MFCD00079665 |
| Molecular Weight | 320.31 |
| MOL File | 94442-22-5.mol |
Chemical Properties
| Appearance | white to off-white crystals or crystalline powder |
| Melting point | 26-29 °C(lit.) |
| Boiling point | 23°C 0,05mm |
| density | 1.88 |
| Fp | 131 °F |
| storage temp. | Refrigerator (+4°C) |
| form | Powder |
| color | off-white |
| Water Solubility | insoluble |
| Sensitive | Air Sensitive |
| Exposure limits | ACGIH: TWA 0.002 mg/m3 NIOSH: IDLH 4 mg/m3; TWA 0.002 mg/m3 |
| InChI | InChI=1S/C6H3.3CH2.Pt/c1-6-4-2-3-5-6;;;;/h1H3;3*1H2;/q4*-1;+4 |
| InChIKey | LHBNZTLXAPHJFP-UHFFFAOYSA-N |
| SMILES | [CH2-][Pt+4]1234(C5C1=C2[C-]3(C)C4=5)([CH2-])[CH2-] |
| CAS DataBase Reference | 94442-22-5(CAS DataBase Reference) |
| EPA Substance Registry System | 94442-22-5(EPA Substance) |
Safety Data
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H300+H310-H317-H400 |
| Precautionary statements | P261-P262-P273-P280-P301+P310-P302+P352+P310 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN3467 - class 6.1 - PG 1 - EHS - Organometallic compound, toxic, solid, n.o.s., HI: all (not BR) |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | 6.1 |
| HS Code | 28439000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Oral Acute Tox. 2 Dermal Aquatic Acute 1 Skin Sens. 1 |