937-20-2
| Name | 2,4'-Dichloroacetophenone |
| CAS | 937-20-2 |
| EINECS(EC#) | 213-323-9 |
| Molecular Formula | C8H6Cl2O |
| MDL Number | MFCD00018926 |
| Molecular Weight | 189.04 |
| MOL File | 937-20-2.mol |
Chemical Properties
| Appearance | white to off-white crystalline powder |
| Melting point | 100-102 °C(lit.) |
| Boiling point | 270 °C(lit.) |
| density | 1.2979 (rough estimate) |
| refractive index | 1.5640 (estimate) |
| Fp | 270°C |
| storage temp. | Storage temp. 2-8°C |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 637861 |
| InChI | InChI=1S/C8H6Cl2O/c9-5-8(11)6-1-3-7(10)4-2-6/h1-4H,5H2 |
| InChIKey | FWDFNLVLIXAOMX-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(Cl)C=C1)CCl |
| CAS DataBase Reference | 937-20-2(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 3 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |