93-97-0
| Name | Benzoic anhydride |
| CAS | 93-97-0 |
| EINECS(EC#) | 202-291-1 |
| Molecular Formula | C14H10O3 |
| MDL Number | MFCD00003073 |
| Molecular Weight | 226.23 |
| MOL File | 93-97-0.mol |
Chemical Properties
| Appearance | white to almost white crystals or crystalline |
| Melting point | 38-42 °C(lit.) |
| Boiling point | 360 °C |
| density | 1.199 g/mL at 25 °C(lit.) |
| refractive index | nD15 1.57665 |
| Fp | >230 °F |
| storage temp. | Store at RT. |
| solubility | 0.01g/l (experimental) |
| form | Crystals or Crystalline Powder |
| color | White to almost white |
| Water Solubility | 0.01 g/L |
| Sensitive | Moisture Sensitive |
| Merck | 14,1092 |
| BRN | 516726 |
| Henry's Law Constant | 7.0×100 mol/(m3Pa) at 25℃, Zhang et al. (2010) |
| InChI | 1S/C14H10O3/c15-13(11-7-3-1-4-8-11)17-14(16)12-9-5-2-6-10-12/h1-10H |
| InChIKey | CHIHQLCVLOXUJW-UHFFFAOYSA-N |
| SMILES | O=C(OC(=O)c1ccccc1)c2ccccc2 |
| CAS DataBase Reference | 93-97-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H315-H318-H372 |
| Precautionary statements | P260-P264-P280-P302+P352-P305+P351+P338-P314 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29163900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT RE 1 Inhalation |