92220-65-0
| Name | Dichlorotetrakis[2-(2-pyridyl)phenyl]diiridiuM(III) |
| CAS | 92220-65-0 |
| Molecular Formula | 4C11H9N.2ClIr |
| MDL Number | MFCD07784515 |
| Molecular Weight | 1076.14 |
| MOL File | 92220-65-0.mol |
Chemical Properties
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Dichloromethane (Slightly), Pyridine (Slightly) |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| InChI | 1S/4C11H9N.2ClH.2Ir/c4*1-2-6-10(7-3-1)11-8-4-5-9-12-11;;;;/h4*1-9H;2*1H;;/q;;;;;;2*+1/p-2 |
| InChIKey | NARZJSRZFGZBIZ-UHFFFAOYSA-L |
| SMILES | Cl[Ir](c1ccccc1-c2ccccn2)c3ccccc3-c4ccccn4.Cl[Ir](c5ccccc5-c6ccccn6)c7ccccc7-c8ccccn8 |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |