
915095-87-3
| Name | (2-Chloro-5-iodophenyl)[4-[[(3S)-tetrahydro-3-furanyl]oxy]phenyl]methanone |
| CAS | 915095-87-3 |
| EINECS(EC#) | 619-598-5 |
| Molecular Formula | C17H14ClIO3 |
| MDL Number | MFCD22665921 |
| Molecular Weight | 428.649 |
| MOL File | 915095-87-3.mol |
Chemical Properties
| Melting point | 109-113oC |
| Boiling point | 526℃ |
| density | 1.639 |
| Fp | 272℃ |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | Off-White to Pale Beige |
| Optical Rotation | Consistent with structure |
| InChI | InChI=1S/C17H14ClIO3/c18-16-6-3-12(19)9-15(16)17(20)11-1-4-13(5-2-11)22-14-7-8-21-10-14/h1-6,9,14H,7-8,10H2/t14-/m0/s1 |
| InChIKey | WBBJCIOCSVFCNI-AWEZNQCLSA-N |
| SMILES | C(C1=CC(I)=CC=C1Cl)(C1=CC=C(O[C@H]2CCOC2)C=C1)=O |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P261-P305+P351+P338 |
| REACH Registrations | Active |

