
903571-02-8
| Name | Bode Catalyst 2 |
| CAS | 903571-02-8 |
| Molecular Formula | C21H22ClN3OH2O |
| MDL Number | MFCD10566989 |
| MOL File | 903571-02-8.mol |
Chemical Properties
| Melting point | 226-230 °C |
| storage temp. | Inert atmosphere,2-8°C |
| form | powder to crystal |
| color | White to Gray to Red |
| Optical Rotation | [α]20/D +158°, c = 1 in chloroform |
| InChI | 1S/C21H22N3O.ClH/c1-13-8-14(2)20(15(3)9-13)24-12-23-19(22-24)11-25-18-10-16-6-4-5-7-17(16)21(18)23;/h4-9,12,18,21H,10-11H2,1-3H3;1H/q+1;/p-1/t18-,21+;/m1./s1 |
| InChIKey | GUECWMLEUCWYOS-WKOQGQMTSA-M |
| SMILES | [Cl-].Cc1cc(C)c(c(C)c1)-[n+]2c[n@@H]3[C@@H]4[C@@H](Cc5ccccc45)OCc3n2 |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
